| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| MEMBRANE POTENTIAL | 9.10±0.59 | human | qHTS-HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 7.08 | human | HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 21.66±15.72 | rat | hepatocytes | MMP assay | decrease | IC50 | 163 | |
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
![]() |
Danger |
Aggregated GHS information provided by 48 companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. H300 (10.42%): Fatal if swallowed [Danger Acute toxicity, oral] H301 (89.58%): Toxic if swallowed [Danger Acute toxicity, oral] H311 (100%): Toxic in contact with skin [Danger Acute toxicity, dermal] H331 (91.67%): Toxic if inhaled [Danger Acute toxicity, inhalation] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P261, P264, P270, P271, P280, P301+P310, P302+P352, P304+P340, P311, P312, P321, P322, P330, P361, P363, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
![]() |
Danger |
H301: Toxic if swallowed [Danger Acute toxicity, oral] H311: Toxic in contact with skin [Danger Acute toxicity, dermal] H331: Toxic if inhaled [Danger Acute toxicity, inhalation] |
P261, P264, P270, P271, P280, P301+P310, P302+P352, P304+P340, P311, P312, P321, P322, P330, P361, P363, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
![]() |
Danger |
H300: Fatal if swallowed [Danger Acute toxicity, oral] H310: Fatal in contact with skin [Danger Acute toxicity, dermal] H331: Toxic if inhaled [Danger Acute toxicity, inhalation] |
P261, P262, P264, P270, P271, P280, P301+P310, P302+P350, P304+P340, P310, P311, P321, P322, P330, P361, P363, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| (4-aminophenyl)-dimethyl-amine | (4-aminophenyl)dimethylamine | 1,4-Benzenediamine, N,N-dimethyl- |
| 1,4-Benzenediamine, N1,N1-dimethyl- | 1-N,1-N-dimethylbenzene-1,4-diamine | 4-(Dimethylamino)aniline |
| 4-(Dimethylamino)aniline | 4-(Dimethylamino)benzenamine | 4-(Dimethylamino)phenylamine |
| 4-(N,N-dimethylamino)aniline | 4-Amino-N | 4-Amino-N,N-dimethylaniline |
| 4-Amino-N,N-dimethylaniline | 4-Aminodimethylaniline | 4-N,4-N-dimethylbenzene-1,4-diamine |
| 4-dimethylamino aniline | 4-dimethylamino-aniline | 4-dimethylaminoaniline |
| 4CH-011916 | 7GZH2FMK7X | 99-98-9 |
| AB1003350 | ACMC-209seo | AI3-52360 |
| AKOS000101558 | ANW-41086 | AS-47649 |
| BZORFPDSXLZWJF-UHFFFAOYSA- | BZORFPDSXLZWJF-UHFFFAOYSA-N | C.I. 76075 |
| C04203 | CAS-99-98-9 | CCRIS 6024 |
| CHEBI:15783 | CHEMBL36296 | CI 76075 |
| CTK3J6319 | D0779 | DMPD |
| DMPPDA; | DSSTox_CID_5149 | DSSTox_GSID_25149 |
| DSSTox_RID_77688 | DTXSID6025149 | Dimethyl-4-phenylenediamine |
| Dimethyl-p-phenylenediamine | Dimethyl-p-phenylenediamine (VAN) | Dimethyl-para-phenylenediamine |
| Dimethyl-paraphenylenediamine | EINECS 202-807-5 | F2190-0446 |
| HSDB 5330 | InChI=1/C8H12N2/c1-10(2)8-5-3-7(9)4-6-8/h3-6H,9H2,1-2H3 | KS-00000VAK |
| KSC496G1T | LS-287 | MCULE-4782652197 |
| MFCD00007860 | N',N'-dimethyl-benzene-1,4-diamine | N',N'-dimethyl-p-phenylene diamine |
| N, N-dimethyl-para-phenylene diamine | N,N-DIMETHYL-P-BENZENEDIAMINE | N,N-Dimethyl-1,4-benzenediamine |
| N,N-Dimethyl-1,4-phenylenediamine | N,N-Dimethyl-1,4-phenylenediamine | N,N-Dimethyl-p-fenylendiamin |
| N,N-Dimethyl-p-fenylendiamin [Czech] | N,N-Dimethyl-p-phenylenediamine | N,N-Dimethyl-p-phenylenediamine, 97% |
| N,N-Dimethyl-p-phenylenediamine, for spectrophotometric det. of SO42-, S2-, >=97.0% | N,N-Dimethyl-p-phenylenediamine, technical, >=95.0% (GC) | N,N-dimethyl paraphenylenediamine |
| N,N-dimethyl-1,4-diamino-benzene | N,N-dimethyl-benzene-1,4-diamine | N,N-dimethylbenzene-1,4-diamine |
| N1,N1-Dimethylbenzene-1,4-diamine | NCGC00091245-01 | NCGC00091245-02 |
| NCGC00257745-01 | NE10522 | NSC 1493 |
| NSC-1493 | NSC1493 | Q-201433 |
| Q409957 | RTR-033076 | SBB058715 |
| SC-65295 | SCHEMBL15246 | ST24025677 |
| ST51037495 | STL255600 | TR-033076 |
| TRA0054903 | Tox21_200191 | UNII-7GZH2FMK7X |
| WLN: ZR DN1 & 1 | ZINC56911 | n,n-dimethyl-p-phenylendiamine |
| n,n-dimethyl-p-phenylene-diamine | p-(Dimethylamino)aniline | p-(Dimethylamino)phenylamine |
| p-Amino-N,N-dimethylaniline | p-Aminodimethylaniline | p-Dimethylaminophenylamine |
| p-Phenylenediamine, N,N-dimethyl- | p-dimethylaminoaniline |